About 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane
2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane (PubChem CID 169159771) has the molecular formula C11H16F2N2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane |
| PubChem CID | 169159771 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane |
| SMILES | CC.Cn1c(C(F)F)nc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10F2N2.C2H6/c1-13-7-5-3-2-4-6(7)12-9(13)8(10)11;1-2/h4-5,8H,2-3H2,1H3;1-2H3 |
| InChIKey | OPUDMGXOCGDZGL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane?
The IUPAC name of 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane (CID 169159771) is 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane.
What is the SMILES notation for 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane?
The canonical SMILES for 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane is CC.Cn1c(C(F)F)nc2c1=CCCC=2.
What is the InChIKey of 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane?
The InChIKey is OPUDMGXOCGDZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2.C2H6/c1-13-7-5-3-2-4-6(7)12-9(13)8(10)11;1-2/h4-5,8H,2-3H2,1H3;1-2H3.
What are the key properties of 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane?
2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane has a molecular weight of 214.26 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1-methyl-5,6-dihydrobenzimidazole;ethane is sourced from PubChem (CID 169159771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).