C21H25FN2O — CID 169160385
3-fluoro-4-[[(2E,4Z)-6-(2-methylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]oxymethyl]benzonitrile (PubChem CID 169160385) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is 3-fluoro-4-[[(2E,4Z)-6-(2-methylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]oxymethyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[(2E,4Z)-6-(2-methylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 169160385 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-fluoro-4-[[(2E,4Z)-6-(2-methylpiperidin-4-yl)hepta-2,4,6-trien-2-yl]oxymethyl]benzonitrile |
| SMILES | C=C(/C=C\C=C(/C)OCc1ccc(C#N)cc1F)C1CCNC(C)C1 |
| InChI | InChI=1S/C21H25FN2O/c1-15(19-9-10-24-16(2)11-19)5-4-6-17(3)25-14-20-8-7-18(13-23)12-21(20)22/h4-8,12,16,19,24H,1,9-11,14H2,2-3H3/b5-4-,17-6+ |
| InChIKey | HORSQAJRRKSDPR-JCFRVBNTSA-N |
| XLogP | 4.62 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|