C16H19ClF3N3OS — CID 169160933
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane (PubChem CID 169160933) has the molecular formula C16H19ClF3N3OS and a molecular weight of 393.86 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 169160933 |
| Molecular Formula | C16H19ClF3N3OS |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
| SMILES | FC(F)(F)c1cnc(SN2CC3(C2)CN(C2CCOCC2)C3)c(Cl)c1 |
| InChI | InChI=1S/C16H19ClF3N3OS/c17-13-5-11(16(18,19)20)6-21-14(13)25-23-9-15(10-23)7-22(8-15)12-1-3-24-4-2-12/h5-6,12H,1-4,7-10H2 |
| InChIKey | NWBRNQXQFUSJPC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|