C19H26F3N3OS — CID 169160944
2-[[4-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-ylmethyl)-2,6-diazaspiro[3.3]heptane (PubChem CID 169160944) has the molecular formula C19H26F3N3OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-[[4-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-ylmethyl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-[[4-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-ylmethyl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 169160944 |
| Molecular Formula | C19H26F3N3OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-[[4-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-ylmethyl)-2,6-diazaspiro[3.3]heptane |
| SMILES | CCc1cc(C(F)(F)F)ncc1SN1CC2(CN(CC3CCOCC3)C2)C1 |
| InChI | InChI=1S/C19H26F3N3OS/c1-2-15-7-17(19(20,21)22)23-8-16(15)27-25-12-18(13-25)10-24(11-18)9-14-3-5-26-6-4-14/h7-8,14H,2-6,9-13H2,1H3 |
| InChIKey | IVXOSEHWAVEREP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|