About ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione
ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione (PubChem CID 169161651) has the molecular formula C16H26FNO2
and a molecular weight of 283.39 g/mol. Its IUPAC name is ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione.
Molecular Properties
| Compound Name | ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione |
| PubChem CID | 169161651 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione |
| SMILES | CC.CC.CC.Cc1cc2c(cc1F)C(=O)N(C)C2=O |
| InChI | InChI=1S/C10H8FNO2.3C2H6/c1-5-3-6-7(4-8(5)11)10(14)12(2)9(6)13;3*1-2/h3-4H,1-2H3;3*1-2H3 |
| InChIKey | XYTLUXCXOPAWKG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione?
The IUPAC name of ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione (CID 169161651) is ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione.
What is the SMILES notation for ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione?
The canonical SMILES for ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione is CC.CC.CC.Cc1cc2c(cc1F)C(=O)N(C)C2=O.
What is the InChIKey of ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione?
The InChIKey is XYTLUXCXOPAWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO2.3C2H6/c1-5-3-6-7(4-8(5)11)10(14)12(2)9(6)13;3*1-2/h3-4H,1-2H3;3*1-2H3.
What are the key properties of ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione?
ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione has a molecular weight of 283.39 g/mol, XLogP of 4.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-2,6-dimethylisoindole-1,3-dione is sourced from PubChem (CID 169161651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).