About lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate
lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate (PubChem CID 169162817) has the molecular formula C5H4F2LiN3O2
and a molecular weight of 183.04 g/mol. Its IUPAC name is lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 169162817 |
| Molecular Formula | C5H4F2LiN3O2 |
| Molecular Weight | 183.04 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate |
| SMILES | Cn1nc(C(F)F)nc1C(=O)[O-].[Li+] |
| InChI | InChI=1S/C5H5F2N3O2.Li/c1-10-4(5(11)12)8-3(9-10)2(6)7;/h2H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | HIEXFCOMBRFJBZ-UHFFFAOYSA-M |
| XLogP | -3.88 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.04 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate (CID 169162817) is lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate is Cn1nc(C(F)F)nc1C(=O)[O-].[Li+].
What is the InChIKey of lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate?
The InChIKey is HIEXFCOMBRFJBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5F2N3O2.Li/c1-10-4(5(11)12)8-3(9-10)2(6)7;/h2H,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate?
lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate has a molecular weight of 183.04 g/mol, XLogP of -3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 5-(difluoromethyl)-2-methyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 169162817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).