C23H14F4N6O3 — CID 169163093
[(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-pyridin-2-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone (PubChem CID 169163093) has the molecular formula C23H14F4N6O3 and a molecular weight of 498.40 g/mol. Its IUPAC name is [(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-pyridin-2-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone.
| Compound Name | [(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-pyridin-2-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 169163093 |
| Molecular Formula | C23H14F4N6O3 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-pyridin-2-yl-4-(trifluoromethyl)-1,3-oxazol-5-yl]methanone |
| SMILES | O=C(c1oc(-c2ccccn2)nc1C(F)(F)F)N1CCc2[nH]cnc2[C@H]1c1nc2cc(F)ccc2o1 |
| InChI | InChI=1S/C23H14F4N6O3/c24-11-4-5-15-14(9-11)31-21(35-15)17-16-12(29-10-30-16)6-8-33(17)22(34)18-19(23(25,26)27)32-20(36-18)13-3-1-2-7-28-13/h1-5,7,9-10,17H,6,8H2,(H,29,30)/t17-/m0/s1 |
| InChIKey | VOINUBBFYDKHQD-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |