C19H14F3N5O2S — CID 169163106
[2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 169163106) has the molecular formula C19H14F3N5O2S and a molecular weight of 433.42 g/mol. Its IUPAC name is [2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 169163106 |
| Molecular Formula | C19H14F3N5O2S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [2-(1,1-difluoroethyl)-1,3-thiazol-5-yl]-[(4S)-4-(5-fluoro-1,3-benzoxazol-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CC(F)(F)c1ncc(C(=O)N2CCc3[nH]cnc3[C@H]2c2nc3cc(F)ccc3o2)s1 |
| InChI | InChI=1S/C19H14F3N5O2S/c1-19(21,22)18-23-7-13(30-18)17(28)27-5-4-10-14(25-8-24-10)15(27)16-26-11-6-9(20)2-3-12(11)29-16/h2-3,6-8,15H,4-5H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | XTRUDKKELXAADR-HNNXBMFYSA-N |
| XLogP | 4.05 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |