C19H29N3O3 — CID 169163594
2-[(Z)-2-hydroxy-2,4-dimethylhex-3-en-3-yl]oxy-3-methyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)but-2-en-1-one (PubChem CID 169163594) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[(Z)-2-hydroxy-2,4-dimethylhex-3-en-3-yl]oxy-3-methyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)but-2-en-1-one.
| Compound Name | 2-[(Z)-2-hydroxy-2,4-dimethylhex-3-en-3-yl]oxy-3-methyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 169163594 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[(Z)-2-hydroxy-2,4-dimethylhex-3-en-3-yl]oxy-3-methyl-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)but-2-en-1-one |
| SMILES | CC/C(C)=C(\OC(C(=O)N1CCc2nc[nH]c2C1)=C(C)C)C(C)(C)O |
| InChI | InChI=1S/C19H29N3O3/c1-7-13(4)17(19(5,6)24)25-16(12(2)3)18(23)22-9-8-14-15(10-22)21-11-20-14/h11,24H,7-10H2,1-6H3,(H,20,21)/b17-13- |
| InChIKey | DPZRSPURRQLVBZ-LGMDPLHJSA-N |
| XLogP | 3.06 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|