C24H18FN5O2S — CID 169163616
[(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanone (PubChem CID 169163616) has the molecular formula C24H18FN5O2S and a molecular weight of 459.51 g/mol. Its IUPAC name is [(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 169163616 |
| Molecular Formula | C24H18FN5O2S |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [(4S)-4-(5-fluoro-3-methyl-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-(2-pyridin-2-yl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1c([C@@H]2c3nc[nH]c3CCN2C(=O)c2cnc(-c3ccccn3)s2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C24H18FN5O2S/c1-13-15-10-14(25)5-6-18(15)32-22(13)21-20-16(28-12-29-20)7-9-30(21)24(31)19-11-27-23(33-19)17-4-2-3-8-26-17/h2-6,8,10-12,21H,7,9H2,1H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | OZQYDBSQZPVHRW-NRFANRHFSA-N |
| XLogP | 4.91 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |