C20H17FN4O2S — CID 169163713
1-[(4R)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-(1,3-thiazol-2-yl)propan-1-one (PubChem CID 169163713) has the molecular formula C20H17FN4O2S and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[(4R)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-(1,3-thiazol-2-yl)propan-1-one.
| Compound Name | 1-[(4R)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-(1,3-thiazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 169163713 |
| Molecular Formula | C20H17FN4O2S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[(4R)-4-(5-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-3-(1,3-thiazol-2-yl)propan-1-one |
| SMILES | O=C(CCc1nccs1)N1CCc2[nH]cnc2[C@@H]1c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C20H17FN4O2S/c21-13-1-2-15-12(9-13)10-16(27-15)20-19-14(23-11-24-19)5-7-25(20)18(26)4-3-17-22-6-8-28-17/h1-2,6,8-11,20H,3-5,7H2,(H,23,24)/t20-/m0/s1 |
| InChIKey | NGFWJMGCESDAGF-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |