C22H20F2N4O3 — CID 169163934
[(4R)-4-(3-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(2-fluoropropan-2-yl)-4-methyl-1,3-oxazol-5-yl]methanone (PubChem CID 169163934) has the molecular formula C22H20F2N4O3 and a molecular weight of 426.42 g/mol. Its IUPAC name is [(4R)-4-(3-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(2-fluoropropan-2-yl)-4-methyl-1,3-oxazol-5-yl]methanone.
| Compound Name | [(4R)-4-(3-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(2-fluoropropan-2-yl)-4-methyl-1,3-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 169163934 |
| Molecular Formula | C22H20F2N4O3 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [(4R)-4-(3-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-(2-fluoropropan-2-yl)-4-methyl-1,3-oxazol-5-yl]methanone |
| SMILES | Cc1nc(C(C)(C)F)oc1C(=O)N1CCc2[nH]cnc2[C@@H]1c1oc2ccccc2c1F |
| InChI | InChI=1S/C22H20F2N4O3/c1-11-18(31-21(27-11)22(2,3)24)20(29)28-9-8-13-16(26-10-25-13)17(28)19-15(23)12-6-4-5-7-14(12)30-19/h4-7,10,17H,8-9H2,1-3H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | KRIYHGBNSABTQH-QGZVFWFLSA-N |
| XLogP | 4.58 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |