C24H16F3N5O2S — CID 169164065
[(4S)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-5-yl]methanone (PubChem CID 169164065) has the molecular formula C24H16F3N5O2S and a molecular weight of 495.49 g/mol. Its IUPAC name is [(4S)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-5-yl]methanone.
| Compound Name | [(4S)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 169164065 |
| Molecular Formula | C24H16F3N5O2S |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | [(4S)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(-c2cc(C(F)(F)F)ccn2)s1)N1CCc2[nH]cnc2[C@H]1c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H16F3N5O2S/c25-24(26,27)14-5-7-28-16(10-14)22-29-11-19(35-22)23(33)32-8-6-15-20(31-12-30-15)21(32)18-9-13-3-1-2-4-17(13)34-18/h1-5,7,9-12,21H,6,8H2,(H,30,31)/t21-/m1/s1 |
| InChIKey | ZYEHJQNDXXVQEF-OAQYLSRUSA-N |
| XLogP | 5.48 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |