C23H18N4O2S — CID 169164160
1-[(4R)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,3-benzothiazol-2-yl)ethanone (PubChem CID 169164160) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-[(4R)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,3-benzothiazol-2-yl)ethanone.
| Compound Name | 1-[(4R)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,3-benzothiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 169164160 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[(4R)-4-(1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-2-(1,3-benzothiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nc2ccccc2s1)N1CCc2[nH]cnc2[C@@H]1c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H18N4O2S/c28-21(12-20-26-15-6-2-4-8-19(15)30-20)27-10-9-16-22(25-13-24-16)23(27)18-11-14-5-1-3-7-17(14)29-18/h1-8,11,13,23H,9-10,12H2,(H,24,25)/t23-/m0/s1 |
| InChIKey | JTGHNKORVNAJLJ-QHCPKHFHSA-N |
| XLogP | 4.48 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |