C23H17FN4O2S — CID 169164654
2-(1,3-benzothiazol-2-yl)-1-[(4R)-4-(4-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone (PubChem CID 169164654) has the molecular formula C23H17FN4O2S and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-[(4R)-4-(4-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-[(4R)-4-(4-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 169164654 |
| Molecular Formula | C23H17FN4O2S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-[(4R)-4-(4-fluoro-1-benzofuran-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone |
| SMILES | O=C(Cc1nc2ccccc2s1)N1CCc2[nH]cnc2[C@@H]1c1cc2c(F)cccc2o1 |
| InChI | InChI=1S/C23H17FN4O2S/c24-14-4-3-6-17-13(14)10-18(30-17)23-22-16(25-12-26-22)8-9-28(23)21(29)11-20-27-15-5-1-2-7-19(15)31-20/h1-7,10,12,23H,8-9,11H2,(H,25,26)/t23-/m0/s1 |
| InChIKey | RVCSPLLWFNHCED-QHCPKHFHSA-N |
| XLogP | 4.62 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |