C23H28ClFN6O2 — CID 169164723
[4-[(E,1Z)-1-(6-chloro-3,4-dihydro-1H-pyridin-2-ylidene)hex-2-en-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone (PubChem CID 169164723) has the molecular formula C23H28ClFN6O2 and a molecular weight of 474.97 g/mol. Its IUPAC name is [4-[(E,1Z)-1-(6-chloro-3,4-dihydro-1H-pyridin-2-ylidene)hex-2-en-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone.
| Compound Name | [4-[(E,1Z)-1-(6-chloro-3,4-dihydro-1H-pyridin-2-ylidene)hex-2-en-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 169164723 |
| Molecular Formula | C23H28ClFN6O2 |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [4-[(E,1Z)-1-(6-chloro-3,4-dihydro-1H-pyridin-2-ylidene)hex-2-en-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone |
| SMILES | CCC/C=C(\C=C1\CCC=C(Cl)N1)C1c2nc[nH]c2CCN1C(=O)c1nnc(C(C)(C)F)o1 |
| InChI | InChI=1S/C23H28ClFN6O2/c1-4-5-7-14(12-15-8-6-9-17(24)28-15)19-18-16(26-13-27-18)10-11-31(19)21(32)20-29-30-22(33-20)23(2,3)25/h7,9,12-13,19,28H,4-6,8,10-11H2,1-3H3,(H,26,27)/b14-7+,15-12- |
| InChIKey | MVADXRXEDKHOHG-NKUZYOJVSA-N |
| XLogP | 4.81 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|