C11H14F3N — CID 169164822
(2E,4Z,6E)-3-methyl-7-(trifluoromethyl)nona-2,4,6-trien-1-imine (PubChem CID 169164822) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is (2E,4Z,6E)-3-methyl-7-(trifluoromethyl)nona-2,4,6-trien-1-imine.
| Compound Name | (2E,4Z,6E)-3-methyl-7-(trifluoromethyl)nona-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 169164822 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2E,4Z,6E)-3-methyl-7-(trifluoromethyl)nona-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/C=C(C)/C=C\C=C(/CC)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N/c1-3-10(11(12,13)14)6-4-5-9(2)7-8-15/h4-8,15H,3H2,1-2H3/b5-4-,9-7+,10-6+,15-8+ |
| InChIKey | DORUQKLUXSPHDX-ATRVTORLSA-N |
| XLogP | 4.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|