C11H16FN — CID 169165910
(2E,4E,6Z)-4-fluoro-3-methyldeca-2,4,6-trien-1-imine (PubChem CID 169165910) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (2E,4E,6Z)-4-fluoro-3-methyldeca-2,4,6-trien-1-imine.
| Compound Name | (2E,4E,6Z)-4-fluoro-3-methyldeca-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 169165910 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (2E,4E,6Z)-4-fluoro-3-methyldeca-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/C=C(C)/C(F)=C\C=C/CCC |
| InChI | InChI=1S/C11H16FN/c1-3-4-5-6-7-11(12)10(2)8-9-13/h5-9,13H,3-4H2,1-2H3/b6-5-,10-8+,11-7+,13-9+ |
| InChIKey | KJXAVJKQRCULJP-ONNQKDILSA-N |
| XLogP | 3.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|