About 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde
7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde (PubChem CID 169166219) has the molecular formula C8H5FN2O
and a molecular weight of 164.14 g/mol. Its IUPAC name is 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde |
| PubChem CID | 169166219 |
| Molecular Formula | C8H5FN2O |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2cccc(F)n2n1 |
| InChI | InChI=1S/C8H5FN2O/c9-8-3-1-2-7-4-6(5-12)10-11(7)8/h1-5H |
| InChIKey | HSNJRDYGGZZPFY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde?
The IUPAC name of 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde (CID 169166219) is 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde.
What is the SMILES notation for 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde?
The canonical SMILES for 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde is O=Cc1cc2cccc(F)n2n1.
What is the InChIKey of 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde?
The InChIKey is HSNJRDYGGZZPFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2O/c9-8-3-1-2-7-4-6(5-12)10-11(7)8/h1-5H.
What are the key properties of 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde?
7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde has a molecular weight of 164.14 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoropyrazolo[1,5-a]pyridine-2-carbaldehyde is sourced from PubChem (CID 169166219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).