C10H14FN — CID 169166390
(2E,4E,6Z)-4-fluoro-3-methylnona-2,4,6-trien-1-imine (PubChem CID 169166390) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is (2E,4E,6Z)-4-fluoro-3-methylnona-2,4,6-trien-1-imine.
| Compound Name | (2E,4E,6Z)-4-fluoro-3-methylnona-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 169166390 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (2E,4E,6Z)-4-fluoro-3-methylnona-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/C=C(C)/C(F)=C\C=C/CC |
| InChI | InChI=1S/C10H14FN/c1-3-4-5-6-10(11)9(2)7-8-12/h4-8,12H,3H2,1-2H3/b5-4-,9-7+,10-6+,12-8+ |
| InChIKey | MQPSZMABBLXOBI-NPTBOGAVSA-N |
| XLogP | 3.40 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|