C19H20N8O2 — CID 169166408
(2,5-dimethyl-1,2,4-triazol-3-yl)-[(4S)-4-(4-methoxypyrazolo[1,5-a]pyridin-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 169166408) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is (2,5-dimethyl-1,2,4-triazol-3-yl)-[(4S)-4-(4-methoxypyrazolo[1,5-a]pyridin-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | (2,5-dimethyl-1,2,4-triazol-3-yl)-[(4S)-4-(4-methoxypyrazolo[1,5-a]pyridin-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 169166408 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2,5-dimethyl-1,2,4-triazol-3-yl)-[(4S)-4-(4-methoxypyrazolo[1,5-a]pyridin-2-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | COc1cccn2nc([C@@H]3c4nc[nH]c4CCN3C(=O)c3nc(C)nn3C)cc12 |
| InChI | InChI=1S/C19H20N8O2/c1-11-22-18(25(2)23-11)19(28)26-8-6-12-16(21-10-20-12)17(26)13-9-14-15(29-3)5-4-7-27(14)24-13/h4-5,7,9-10,17H,6,8H2,1-3H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | UBXYYYVODLDEAK-QGZVFWFLSA-N |
| XLogP | 1.29 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |