C24H18F3N7OS — CID 169166460
[(4R)-4-isoquinolin-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3-thiazol-5-yl]methanone (PubChem CID 169166460) has the molecular formula C24H18F3N7OS and a molecular weight of 509.52 g/mol. Its IUPAC name is [(4R)-4-isoquinolin-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3-thiazol-5-yl]methanone.
| Compound Name | [(4R)-4-isoquinolin-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 169166460 |
| Molecular Formula | C24H18F3N7OS |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | [(4R)-4-isoquinolin-3-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[2-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(-c2cnn(CC(F)(F)F)c2)s1)N1CCc2[nH]cnc2[C@H]1c1cc2ccccc2cn1 |
| InChI | InChI=1S/C24H18F3N7OS/c25-24(26,27)12-33-11-16(9-32-33)22-29-10-19(36-22)23(35)34-6-5-17-20(31-13-30-17)21(34)18-7-14-3-1-2-4-15(14)8-28-18/h1-4,7-11,13,21H,5-6,12H2,(H,30,31)/t21-/m1/s1 |
| InChIKey | RXUVMEACZIKPLI-OAQYLSRUSA-N |
| XLogP | 4.63 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |