C22H20ClN5O3 — CID 169166479
[4-chloro-2-(2-hydroxypropan-2-yl)-1,3-oxazol-5-yl]-[(4S)-4-quinolin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 169166479) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is [4-chloro-2-(2-hydroxypropan-2-yl)-1,3-oxazol-5-yl]-[(4S)-4-quinolin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | [4-chloro-2-(2-hydroxypropan-2-yl)-1,3-oxazol-5-yl]-[(4S)-4-quinolin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 169166479 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [4-chloro-2-(2-hydroxypropan-2-yl)-1,3-oxazol-5-yl]-[(4S)-4-quinolin-2-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CC(C)(O)c1nc(Cl)c(C(=O)N2CCc3[nH]cnc3[C@H]2c2ccc3ccccc3n2)o1 |
| InChI | InChI=1S/C22H20ClN5O3/c1-22(2,30)21-27-19(23)18(31-21)20(29)28-10-9-14-16(25-11-24-14)17(28)15-8-7-12-5-3-4-6-13(12)26-15/h3-8,11,17,30H,9-10H2,1-2H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | PZIMGMKOFPFGHQ-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |