C8H4ClF3N4O2 — CID 169166888
5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3,4-oxadiazole-2-carbonyl chloride (PubChem CID 169166888) has the molecular formula C8H4ClF3N4O2 and a molecular weight of 280.59 g/mol. Its IUPAC name is 5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3,4-oxadiazole-2-carbonyl chloride.
| Compound Name | 5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3,4-oxadiazole-2-carbonyl chloride |
|---|---|
| PubChem CID | 169166888 |
| Molecular Formula | C8H4ClF3N4O2 |
| Molecular Weight | 280.59 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 5-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,3,4-oxadiazole-2-carbonyl chloride |
| SMILES | O=C(Cl)c1nnc(-c2cnn(CC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C8H4ClF3N4O2/c9-5(17)7-15-14-6(18-7)4-1-13-16(2-4)3-8(10,11)12/h1-2H,3H2 |
| InChIKey | MPXNUIDFFHWCSY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.59 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|