About 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole
5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole (PubChem CID 169167384) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole |
| PubChem CID | 169167384 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole |
| SMILES | CCC(C)c1cnc(-c2cnn(C)c2C)o1 |
| InChI | InChI=1S/C12H17N3O/c1-5-8(2)11-7-13-12(16-11)10-6-14-15(4)9(10)3/h6-8H,5H2,1-4H3 |
| InChIKey | CHFKUZRMUIQMKB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole?
The IUPAC name of 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole (CID 169167384) is 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole.
What is the SMILES notation for 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole?
The canonical SMILES for 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole is CCC(C)c1cnc(-c2cnn(C)c2C)o1.
What is the InChIKey of 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole?
The InChIKey is CHFKUZRMUIQMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-5-8(2)11-7-13-12(16-11)10-6-14-15(4)9(10)3/h6-8H,5H2,1-4H3.
What are the key properties of 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole?
5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole has a molecular weight of 219.29 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2-(1,5-dimethylpyrazol-4-yl)-1,3-oxazole is sourced from PubChem (CID 169167384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).