C23H30F3N5O4 — CID 169168066
6-amino-1-benzyl-3-ethyl-5-(2-piperidin-1-ylacetyl)pyrimidine-2,4-dione;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 169168066) has the molecular formula C23H30F3N5O4 and a molecular weight of 497.52 g/mol. Its IUPAC name is 6-amino-1-benzyl-3-ethyl-5-(2-piperidin-1-ylacetyl)pyrimidine-2,4-dione;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | 6-amino-1-benzyl-3-ethyl-5-(2-piperidin-1-ylacetyl)pyrimidine-2,4-dione;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 169168066 |
| Molecular Formula | C23H30F3N5O4 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 6-amino-1-benzyl-3-ethyl-5-(2-piperidin-1-ylacetyl)pyrimidine-2,4-dione;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | CCn1c(=O)c(C(=O)CN2CCCCC2)c(N)n(Cc2ccccc2)c1=O.O=CNCC(F)(F)F |
| InChI | InChI=1S/C20H26N4O3.C3H4F3NO/c1-2-23-19(26)17(16(25)14-22-11-7-4-8-12-22)18(21)24(20(23)27)13-15-9-5-3-6-10-15;4-3(5,6)1-7-2-8/h3,5-6,9-10H,2,4,7-8,11-14,21H2,1H3;2H,1H2,(H,7,8) |
| InChIKey | QXVFAHNMDAQRRL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|