About N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide
N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide (PubChem CID 169168968) has the molecular formula C8H6FN3O2
and a molecular weight of 195.15 g/mol. Its IUPAC name is N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide.
Molecular Properties
| Compound Name | N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide |
| PubChem CID | 169168968 |
| Molecular Formula | C8H6FN3O2 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide |
| SMILES | O=CNc1cc2[nH]c(=O)[nH]c2cc1F |
| InChI | InChI=1S/C8H6FN3O2/c9-4-1-6-7(12-8(14)11-6)2-5(4)10-3-13/h1-3H,(H,10,13)(H2,11,12,14) |
| InChIKey | PQJUCFDYJJLKOA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide?
The IUPAC name of N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide (CID 169168968) is N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide.
What is the SMILES notation for N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide?
The canonical SMILES for N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide is O=CNc1cc2[nH]c(=O)[nH]c2cc1F.
What is the InChIKey of N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide?
The InChIKey is PQJUCFDYJJLKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O2/c9-4-1-6-7(12-8(14)11-6)2-5(4)10-3-13/h1-3H,(H,10,13)(H2,11,12,14).
What are the key properties of N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide?
N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide has a molecular weight of 195.15 g/mol, XLogP of 0.56, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-2-oxo-1,3-dihydrobenzimidazol-5-yl)formamide is sourced from PubChem (CID 169168968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).