C19H27F2N3O3 — CID 169169264
N-[4-cyclobutyl-5-(3,3-dimethoxycyclobutyl)-2-methylpyrazol-3-yl]-3,3-difluorocyclobutane-1-carboxamide (PubChem CID 169169264) has the molecular formula C19H27F2N3O3 and a molecular weight of 383.44 g/mol. Its IUPAC name is N-[4-cyclobutyl-5-(3,3-dimethoxycyclobutyl)-2-methylpyrazol-3-yl]-3,3-difluorocyclobutane-1-carboxamide.
| Compound Name | N-[4-cyclobutyl-5-(3,3-dimethoxycyclobutyl)-2-methylpyrazol-3-yl]-3,3-difluorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 169169264 |
| Molecular Formula | C19H27F2N3O3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[4-cyclobutyl-5-(3,3-dimethoxycyclobutyl)-2-methylpyrazol-3-yl]-3,3-difluorocyclobutane-1-carboxamide |
| SMILES | COC1(OC)CC(c2nn(C)c(NC(=O)C3CC(F)(F)C3)c2C2CCC2)C1 |
| InChI | InChI=1S/C19H27F2N3O3/c1-24-16(22-17(25)13-7-18(20,21)8-13)14(11-5-4-6-11)15(23-24)12-9-19(10-12,26-2)27-3/h11-13H,4-10H2,1-3H3,(H,22,25) |
| InChIKey | VHGLLTVFASWYED-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|