About N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide
N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide (PubChem CID 169169267) has the molecular formula C18H27F2N3O
and a molecular weight of 339.43 g/mol. Its IUPAC name is N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide |
| PubChem CID | 169169267 |
| Molecular Formula | C18H27F2N3O |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1c(C2CCC2)c(CC2CC(F)(F)C2)nn1C |
| InChI | InChI=1S/C18H27F2N3O/c1-11(2)7-15(24)21-17-16(13-5-4-6-13)14(22-23(17)3)8-12-9-18(19,20)10-12/h11-13H,4-10H2,1-3H3,(H,21,24) |
| InChIKey | RSVXDJWBBVDUDZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide?
The IUPAC name of N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide (CID 169169267) is N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide.
What is the SMILES notation for N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide?
The canonical SMILES for N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide is CC(C)CC(=O)Nc1c(C2CCC2)c(CC2CC(F)(F)C2)nn1C.
What is the InChIKey of N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide?
The InChIKey is RSVXDJWBBVDUDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F2N3O/c1-11(2)7-15(24)21-17-16(13-5-4-6-13)14(22-23(17)3)8-12-9-18(19,20)10-12/h11-13H,4-10H2,1-3H3,(H,21,24).
What are the key properties of N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide?
N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide has a molecular weight of 339.43 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-cyclobutyl-3-[(3,3-difluorocyclobutyl)methyl]-1-methylpyrazol-5-yl]-3-methylbutanamide is sourced from PubChem (CID 169169267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).