About 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate
2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate (PubChem CID 169169293) has the molecular formula C15H19F4N3O2
and a molecular weight of 349.33 g/mol. Its IUPAC name is 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate |
| PubChem CID | 169169293 |
| Molecular Formula | C15H19F4N3O2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate |
| SMILES | Cc1c(C2CC(F)(F)C2)nn(C2CCC2)c1NC(=O)OCC(F)F |
| InChI | InChI=1S/C15H19F4N3O2/c1-8-12(9-5-15(18,19)6-9)21-22(10-3-2-4-10)13(8)20-14(23)24-7-11(16)17/h9-11H,2-7H2,1H3,(H,20,23) |
| InChIKey | CGWOLNMXPXALPB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate?
The IUPAC name of 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate (CID 169169293) is 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate.
What is the SMILES notation for 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate?
The canonical SMILES for 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate is Cc1c(C2CC(F)(F)C2)nn(C2CCC2)c1NC(=O)OCC(F)F.
What is the InChIKey of 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate?
The InChIKey is CGWOLNMXPXALPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F4N3O2/c1-8-12(9-5-15(18,19)6-9)21-22(10-3-2-4-10)13(8)20-14(23)24-7-11(16)17/h9-11H,2-7H2,1H3,(H,20,23).
What are the key properties of 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate?
2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate has a molecular weight of 349.33 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl N-[2-cyclobutyl-5-(3,3-difluorocyclobutyl)-4-methylpyrazol-3-yl]carbamate is sourced from PubChem (CID 169169293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).