About (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate
(3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate (PubChem CID 169169350) has the molecular formula C17H24F3N3O2
and a molecular weight of 359.39 g/mol. Its IUPAC name is (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate.
Molecular Properties
| Compound Name | (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate |
| PubChem CID | 169169350 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate |
| SMILES | Cn1nc(C2CC(F)(F)C2)c(C(C)(C)C)c1NC(=O)OC1CC(F)C1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-16(2,3)12-13(9-7-17(19,20)8-9)22-23(4)14(12)21-15(24)25-11-5-10(18)6-11/h9-11H,5-8H2,1-4H3,(H,21,24) |
| InChIKey | RKJUUNGVPSEUBH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate?
The IUPAC name of (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate (CID 169169350) is (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate.
What is the SMILES notation for (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate?
The canonical SMILES for (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate is Cn1nc(C2CC(F)(F)C2)c(C(C)(C)C)c1NC(=O)OC1CC(F)C1.
What is the InChIKey of (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate?
The InChIKey is RKJUUNGVPSEUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F3N3O2/c1-16(2,3)12-13(9-7-17(19,20)8-9)22-23(4)14(12)21-15(24)25-11-5-10(18)6-11/h9-11H,5-8H2,1-4H3,(H,21,24).
What are the key properties of (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate?
(3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate has a molecular weight of 359.39 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorocyclobutyl) N-[4-tert-butyl-3-(3,3-difluorocyclobutyl)-1-methylpyrazol-5-yl]carbamate is sourced from PubChem (CID 169169350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).