About 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile
2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile (PubChem CID 169169395) has the molecular formula C11H15F2NO
and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile |
| PubChem CID | 169169395 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile |
| SMILES | CC(C)(C)C(C#N)C(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C11H15F2NO/c1-10(2,3)8(6-14)9(15)7-4-11(12,13)5-7/h7-8H,4-5H2,1-3H3 |
| InChIKey | GXYOGKNETKPCIM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile?
The IUPAC name of 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile (CID 169169395) is 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile.
What is the SMILES notation for 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile?
The canonical SMILES for 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile is CC(C)(C)C(C#N)C(=O)C1CC(F)(F)C1.
What is the InChIKey of 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile?
The InChIKey is GXYOGKNETKPCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO/c1-10(2,3)8(6-14)9(15)7-4-11(12,13)5-7/h7-8H,4-5H2,1-3H3.
What are the key properties of 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile?
2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile has a molecular weight of 215.24 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluorocyclobutanecarbonyl)-3,3-dimethylbutanenitrile is sourced from PubChem (CID 169169395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).