C27H39F2N3O2 — CID 169169409
(3,3-difluorocyclobutyl) N-[4-cyclobutyl-1-methyl-3-[1-[(2E)-nona-2,6,8-trien-2-yl]cyclopropyl]pyrazol-5-yl]carbamate;ethane (PubChem CID 169169409) has the molecular formula C27H39F2N3O2 and a molecular weight of 475.62 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl) N-[4-cyclobutyl-1-methyl-3-[1-[(2E)-nona-2,6,8-trien-2-yl]cyclopropyl]pyrazol-5-yl]carbamate;ethane.
| Compound Name | (3,3-difluorocyclobutyl) N-[4-cyclobutyl-1-methyl-3-[1-[(2E)-nona-2,6,8-trien-2-yl]cyclopropyl]pyrazol-5-yl]carbamate;ethane |
|---|---|
| PubChem CID | 169169409 |
| Molecular Formula | C27H39F2N3O2 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | (3,3-difluorocyclobutyl) N-[4-cyclobutyl-1-methyl-3-[1-[(2E)-nona-2,6,8-trien-2-yl]cyclopropyl]pyrazol-5-yl]carbamate;ethane |
| SMILES | C=CC=CCC/C=C(\C)C1(c2nn(C)c(NC(=O)OC3CC(F)(F)C3)c2C2CCC2)CC1.CC |
| InChI | InChI=1S/C25H33F2N3O2.C2H6/c1-4-5-6-7-8-10-17(2)24(13-14-24)21-20(18-11-9-12-18)22(30(3)29-21)28-23(31)32-19-15-25(26,27)16-19;1-2/h4-6,10,18-19H,1,7-9,11-16H2,2-3H3,(H,28,31);1-2H3/b6-5?,17-10+; |
| InChIKey | LNQWNHVQYVXZGW-BCDOYTFASA-N |
| XLogP | 7.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|