About (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate
(3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate (PubChem CID 169169485) has the molecular formula C16H16F3N3O2
and a molecular weight of 339.32 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate.
Molecular Properties
| Compound Name | (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate |
| PubChem CID | 169169485 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate |
| SMILES | Cn1nc(Cc2ccc(F)cc2)cc1NC(=O)OC1CC(F)(F)C1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-22-14(20-15(23)24-13-8-16(18,19)9-13)7-12(21-22)6-10-2-4-11(17)5-3-10/h2-5,7,13H,6,8-9H2,1H3,(H,20,23) |
| InChIKey | WBILNYBCQPXIEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate?
The IUPAC name of (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate (CID 169169485) is (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate.
What is the SMILES notation for (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate?
The canonical SMILES for (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate is Cn1nc(Cc2ccc(F)cc2)cc1NC(=O)OC1CC(F)(F)C1.
What is the InChIKey of (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate?
The InChIKey is WBILNYBCQPXIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3N3O2/c1-22-14(20-15(23)24-13-8-16(18,19)9-13)7-12(21-22)6-10-2-4-11(17)5-3-10/h2-5,7,13H,6,8-9H2,1H3,(H,20,23).
What are the key properties of (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate?
(3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate has a molecular weight of 339.32 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclobutyl) N-[3-[(4-fluorophenyl)methyl]-1-methylpyrazol-5-yl]carbamate is sourced from PubChem (CID 169169485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).