About 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate
2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate (PubChem CID 169169840) has the molecular formula C13H15F3N2O2S
and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 169169840 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(F)(F)F)s1.N#CCC1CCC1 |
| InChI | InChI=1S/C7H6F3NO2S.C6H9N/c1-2-13-5(12)4-3-11-6(14-4)7(8,9)10;7-5-4-6-2-1-3-6/h3H,2H2,1H3;6H,1-4H2 |
| InChIKey | IFPHIWWCLFMQEY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CID 169169840) is 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate is CCOC(=O)c1cnc(C(F)(F)F)s1.N#CCC1CCC1.
What is the InChIKey of 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The InChIKey is IFPHIWWCLFMQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO2S.C6H9N/c1-2-13-5(12)4-3-11-6(14-4)7(8,9)10;7-5-4-6-2-1-3-6/h3H,2H2,1H3;6H,1-4H2.
What are the key properties of 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate has a molecular weight of 320.34 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylacetonitrile;ethyl 2-(trifluoromethyl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 169169840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).