C18H23ClN6 — CID 169170033
2-[4-(chloromethyl)-2-azabicyclo[2.1.1]hexan-2-yl]-N-(5-cyclopentyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 169170033) has the molecular formula C18H23ClN6 and a molecular weight of 358.88 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2-azabicyclo[2.1.1]hexan-2-yl]-N-(5-cyclopentyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 2-[4-(chloromethyl)-2-azabicyclo[2.1.1]hexan-2-yl]-N-(5-cyclopentyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 169170033 |
| Molecular Formula | C18H23ClN6 |
| Molecular Weight | 358.88 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-[4-(chloromethyl)-2-azabicyclo[2.1.1]hexan-2-yl]-N-(5-cyclopentyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | ClCC12CC(C1)N(c1nccc(Nc3cc(C4CCCC4)[nH]n3)n1)C2 |
| InChI | InChI=1S/C18H23ClN6/c19-10-18-8-13(9-18)25(11-18)17-20-6-5-15(22-17)21-16-7-14(23-24-16)12-3-1-2-4-12/h5-7,12-13H,1-4,8-11H2,(H2,20,21,22,23,24) |
| InChIKey | GLTRKGNFQZGYAR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|