C19H9F5NO5P — CID 169170507
[5-cyano-7-(2,3,4,5,6-pentafluorophenoxy)carbonylnaphthalen-2-yl]methylphosphonic acid (PubChem CID 169170507) has the molecular formula C19H9F5NO5P and a molecular weight of 457.25 g/mol. Its IUPAC name is [5-cyano-7-(2,3,4,5,6-pentafluorophenoxy)carbonylnaphthalen-2-yl]methylphosphonic acid.
| Compound Name | [5-cyano-7-(2,3,4,5,6-pentafluorophenoxy)carbonylnaphthalen-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 169170507 |
| Molecular Formula | C19H9F5NO5P |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | [5-cyano-7-(2,3,4,5,6-pentafluorophenoxy)carbonylnaphthalen-2-yl]methylphosphonic acid |
| SMILES | N#Cc1cc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc2cc(CP(=O)(O)O)ccc12 |
| InChI | InChI=1S/C19H9F5NO5P/c20-13-14(21)16(23)18(17(24)15(13)22)30-19(26)10-4-9-3-8(7-31(27,28)29)1-2-12(9)11(5-10)6-25/h1-5H,7H2,(H2,27,28,29) |
| InChIKey | KRVVPKJWZXZPKI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|