C16H31F2O6P — CID 169170860
[1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane (PubChem CID 169170860) has the molecular formula C16H31F2O6P and a molecular weight of 388.39 g/mol. Its IUPAC name is [1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane.
| Compound Name | [1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane |
|---|---|
| PubChem CID | 169170860 |
| Molecular Formula | C16H31F2O6P |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane |
| SMILES | CC.CC(C)(C)C(=O)OCOP(OCOC(=O)C(C)(C)C)C(C)(F)F |
| InChI | InChI=1S/C14H25F2O6P.C2H6/c1-12(2,3)10(17)19-8-21-23(14(7,15)16)22-9-20-11(18)13(4,5)6;1-2/h8-9H2,1-7H3;1-2H3 |
| InChIKey | YXAZEPDUNHWRJI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|