C19H29NO5S — CID 169171120
tert-butyl (2S,5R)-1-benzyl-5-(2-methylsulfonyloxyethyl)pyrrolidine-2-carboxylate (PubChem CID 169171120) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl (2S,5R)-1-benzyl-5-(2-methylsulfonyloxyethyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,5R)-1-benzyl-5-(2-methylsulfonyloxyethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169171120 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl (2S,5R)-1-benzyl-5-(2-methylsulfonyloxyethyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@H](CCOS(C)(=O)=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO5S/c1-19(2,3)25-18(21)17-11-10-16(12-13-24-26(4,22)23)20(17)14-15-8-6-5-7-9-15/h5-9,16-17H,10-14H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | LYAMUOUVXMKTHJ-SJORKVTESA-N |
| XLogP | 2.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|