About 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal
3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal (PubChem CID 169171145) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal.
Molecular Properties
| Compound Name | 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal |
| PubChem CID | 169171145 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal |
| SMILES | CCN(CCC=O)Cc1ccn2ccnc2c1 |
| InChI | InChI=1S/C13H17N3O/c1-2-15(6-3-9-17)11-12-4-7-16-8-5-14-13(16)10-12/h4-5,7-10H,2-3,6,11H2,1H3 |
| InChIKey | SZCYDGKCYUKWAJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal?
The IUPAC name of 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal (CID 169171145) is 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal.
What is the SMILES notation for 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal?
The canonical SMILES for 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal is CCN(CCC=O)Cc1ccn2ccnc2c1.
What is the InChIKey of 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal?
The InChIKey is SZCYDGKCYUKWAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-2-15(6-3-9-17)11-12-4-7-16-8-5-14-13(16)10-12/h4-5,7-10H,2-3,6,11H2,1H3.
What are the key properties of 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal?
3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal has a molecular weight of 231.30 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(imidazo[1,2-a]pyridin-7-ylmethyl)amino]propanal is sourced from PubChem (CID 169171145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).