C11H21F2O5P — CID 169171146
(1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 169171146) has the molecular formula C11H21F2O5P and a molecular weight of 302.25 g/mol. Its IUPAC name is (1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | (1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 169171146 |
| Molecular Formula | C11H21F2O5P |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CCC(C)C(F)(F)P(=O)(O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H21F2O5P/c1-6-8(2)11(12,13)19(15,16)18-7-17-9(14)10(3,4)5/h8H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | PMSVTOJMWWHZLW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|