C12H13BrF3NO3 — CID 169171262
tert-butyl (1R,4R,7R)-7-bromo-3-oxo-6-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 169171262) has the molecular formula C12H13BrF3NO3 and a molecular weight of 356.14 g/mol. Its IUPAC name is tert-butyl (1R,4R,7R)-7-bromo-3-oxo-6-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl (1R,4R,7R)-7-bromo-3-oxo-6-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 169171262 |
| Molecular Formula | C12H13BrF3NO3 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | tert-butyl (1R,4R,7R)-7-bromo-3-oxo-6-(trifluoromethyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]2C=C(C(F)(F)F)[C@@H]1[C@@H]2Br |
| InChI | InChI=1S/C12H13BrF3NO3/c1-11(2,3)20-10(19)17-8-6(12(14,15)16)4-5(7(8)13)9(17)18/h4-5,7-8H,1-3H3/t5-,7+,8+/m0/s1 |
| InChIKey | FSBJFPVWUJBZCP-UIISKDMLSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|