About 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide
7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide (PubChem CID 169171342) has the molecular formula C15H11N3O5
and a molecular weight of 313.27 g/mol. Its IUPAC name is 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide.
Molecular Properties
| Compound Name | 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide |
| PubChem CID | 169171342 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide |
| SMILES | NC(=O)c1cc2c(cc1[N+](=O)[O-])OCC(=O)N2c1ccccc1 |
| InChI | InChI=1S/C15H11N3O5/c16-15(20)10-6-12-13(7-11(10)18(21)22)23-8-14(19)17(12)9-4-2-1-3-5-9/h1-7H,8H2,(H2,16,20) |
| InChIKey | LBDCCBDEAVKLGM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide?
The IUPAC name of 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide (CID 169171342) is 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide.
What is the SMILES notation for 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide?
The canonical SMILES for 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide is NC(=O)c1cc2c(cc1[N+](=O)[O-])OCC(=O)N2c1ccccc1.
What is the InChIKey of 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide?
The InChIKey is LBDCCBDEAVKLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O5/c16-15(20)10-6-12-13(7-11(10)18(21)22)23-8-14(19)17(12)9-4-2-1-3-5-9/h1-7H,8H2,(H2,16,20).
What are the key properties of 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide?
7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide has a molecular weight of 313.27 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-3-oxo-4-phenyl-1,4-benzoxazine-6-carboxamide is sourced from PubChem (CID 169171342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).