About methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate
methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate (PubChem CID 169171775) has the molecular formula C9H8F3NO2S
and a molecular weight of 251.23 g/mol. Its IUPAC name is methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate |
| PubChem CID | 169171775 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2cnc(C(F)(F)F)s2)CC1 |
| InChI | InChI=1S/C9H8F3NO2S/c1-15-7(14)8(2-3-8)5-4-13-6(16-5)9(10,11)12/h4H,2-3H2,1H3 |
| InChIKey | LTAYXJDRKQVMSL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate (CID 169171775) is methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate is COC(=O)C1(c2cnc(C(F)(F)F)s2)CC1.
What is the InChIKey of methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate?
The InChIKey is LTAYXJDRKQVMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO2S/c1-15-7(14)8(2-3-8)5-4-13-6(16-5)9(10,11)12/h4H,2-3H2,1H3.
What are the key properties of methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate?
methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate has a molecular weight of 251.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopropane-1-carboxylate is sourced from PubChem (CID 169171775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).