C21H32N2O5 — CID 169172040
ethyl 4-methyl-2-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamoyl]pentanoate (PubChem CID 169172040) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamoyl]pentanoate.
| Compound Name | ethyl 4-methyl-2-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamoyl]pentanoate |
|---|---|
| PubChem CID | 169172040 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | ethyl 4-methyl-2-[[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamoyl]pentanoate |
| SMILES | CCOC(=O)C(CC(C)C)C(=O)Nc1cccc(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H32N2O5/c1-7-27-19(25)17(11-14(2)3)18(24)23-16-10-8-9-15(12-16)13-22-20(26)28-21(4,5)6/h8-10,12,14,17H,7,11,13H2,1-6H3,(H,22,26)(H,23,24) |
| InChIKey | YCXXEWNPEWJVNA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|