About 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine
4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine (PubChem CID 169172383) has the molecular formula C17H21ClF3N5S
and a molecular weight of 419.90 g/mol. Its IUPAC name is 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine.
Molecular Properties
| Compound Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine |
| PubChem CID | 169172383 |
| Molecular Formula | C17H21ClF3N5S |
| Molecular Weight | 419.90 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine |
| SMILES | CN.Nc1ccc(SN2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1 |
| InChI | InChI=1S/C16H16ClF3N4S.CH5N/c17-14-9-11(16(18,19)20)10-15(22-14)23-5-7-24(8-6-23)25-13-3-1-12(21)2-4-13;1-2/h1-4,9-10H,5-8,21H2;2H2,1H3 |
| InChIKey | HAYGIVKQBUGUOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine?
The IUPAC name of 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine (CID 169172383) is 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine.
What is the SMILES notation for 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine?
The canonical SMILES for 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine is CN.Nc1ccc(SN2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1.
What is the InChIKey of 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine?
The InChIKey is HAYGIVKQBUGUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClF3N4S.CH5N/c17-14-9-11(16(18,19)20)10-15(22-14)23-5-7-24(8-6-23)25-13-3-1-12(21)2-4-13;1-2/h1-4,9-10H,5-8,21H2;2H2,1H3.
What are the key properties of 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine?
4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine has a molecular weight of 419.90 g/mol, XLogP of 3.74, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;methanamine is sourced from PubChem (CID 169172383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).