C30H39ClF3N7S — CID 169172484
4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;4-N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-2-yl]pent-4-ene-1,3,4-triamine (PubChem CID 169172484) has the molecular formula C30H39ClF3N7S and a molecular weight of 622.21 g/mol. Its IUPAC name is 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;4-N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-2-yl]pent-4-ene-1,3,4-triamine.
| Compound Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;4-N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-2-yl]pent-4-ene-1,3,4-triamine |
|---|---|
| PubChem CID | 169172484 |
| Molecular Formula | C30H39ClF3N7S |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanylaniline;4-N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-2-yl]pent-4-ene-1,3,4-triamine |
| SMILES | C=C/C=C(C=C)\C=C(/C)NC(=C)C(N)CCN.Nc1ccc(SN2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1 |
| InChI | InChI=1S/C16H16ClF3N4S.C14H23N3/c17-14-9-11(16(18,19)20)10-15(22-14)23-5-7-24(8-6-23)25-13-3-1-12(21)2-4-13;1-5-7-13(6-2)10-11(3)17-12(4)14(16)8-9-15/h1-4,9-10H,5-8,21H2;5-7,10,14,17H,1-2,4,8-9,15-16H2,3H3/b;11-10+,13-7- |
| InChIKey | LBTOQGJKFQSOMR-XEKNGUISSA-N |
| XLogP | 6.13 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|