C9H9F5N4O3 — CID 169172584
4,4-difluoro-2-(4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 169172584) has the molecular formula C9H9F5N4O3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 4,4-difluoro-2-(4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4,4-difluoro-2-(4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 169172584 |
| Molecular Formula | C9H9F5N4O3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4,4-difluoro-2-(4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | O=C(NCC(F)(F)F)C(CC(F)F)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H9F5N4O3/c10-7(11)1-6(8(19)15-4-9(12,13)14)17-3-5(2-16-17)18(20)21/h2-3,6-7H,1,4H2,(H,15,19) |
| InChIKey | BPKNYGQPIKLSMO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|