C9H10F4N4O3 — CID 169172610
2-(3-fluoro-4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 169172610) has the molecular formula C9H10F4N4O3 and a molecular weight of 298.20 g/mol. Its IUPAC name is 2-(3-fluoro-4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 2-(3-fluoro-4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 169172610 |
| Molecular Formula | C9H10F4N4O3 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(3-fluoro-4-nitropyrazol-1-yl)-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCC(C(=O)NCC(F)(F)F)n1cc([N+](=O)[O-])c(F)n1 |
| InChI | InChI=1S/C9H10F4N4O3/c1-2-5(8(18)14-4-9(11,12)13)16-3-6(17(19)20)7(10)15-16/h3,5H,2,4H2,1H3,(H,14,18) |
| InChIKey | PPTXPWYXGOJCDE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|