About N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide
N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide (PubChem CID 169172614) has the molecular formula C11H12F4N4O3
and a molecular weight of 324.23 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide.
Molecular Properties
| Compound Name | N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide |
| PubChem CID | 169172614 |
| Molecular Formula | C11H12F4N4O3 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide |
| SMILES | O=C(NC1CC(F)(F)C1)C(CC(F)F)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H12F4N4O3/c12-9(13)1-8(18-5-7(4-16-18)19(21)22)10(20)17-6-2-11(14,15)3-6/h4-6,8-9H,1-3H2,(H,17,20) |
| InChIKey | FSTUDJVVKRKGHH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide?
The IUPAC name of N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide (CID 169172614) is N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide.
What is the SMILES notation for N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide?
The canonical SMILES for N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide is O=C(NC1CC(F)(F)C1)C(CC(F)F)n1cc([N+](=O)[O-])cn1.
What is the InChIKey of N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide?
The InChIKey is FSTUDJVVKRKGHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F4N4O3/c12-9(13)1-8(18-5-7(4-16-18)19(21)22)10(20)17-6-2-11(14,15)3-6/h4-6,8-9H,1-3H2,(H,17,20).
What are the key properties of N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide?
N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide has a molecular weight of 324.23 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclobutyl)-4,4-difluoro-2-(4-nitropyrazol-1-yl)butanamide is sourced from PubChem (CID 169172614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).